Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-BP-0008 |
| Product Name | N-Acetyl-beta-alanyl-L-histidyl-L-seryl-L-histidine |
| CAS | 820959-17-9 |
| Structure |  |
| Synonyms | Acetyl tetrapeptide-5 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-(3-acetamidopropanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| Molecular Weight | 492.49 g/mol |
| Molecular Formula | C20H28N8O7 |
| InChI | InChI=1S/C20H28N8O7/c1-11(30)23-3-2-17(31)26-14(4-12-6-21-9-24-12)18(32)28-16(8-29)19(33)27-15(20(34)35)5-13-7-22-10-25-13/h6-7,9-10,14-16,29H,2-5,8H2,1H3,(H,21,24)(H,22,25)(H,23,30)(H,26,31)(H,27,33)(H,28,32)(H,34,35)/t14-,15-,16-/m0/s1 |
| InChI Key | ROTFCACGLKOUGI-JYJNAYRXSA-N |
| Boiling Point | 1237.3±65.0 °C |
| Purity | 0.95 |
| Density | 1.44 g/mL |
| Appearance | Solid |
| Isomeric SMILES | CC(=O)NCCC(=O)N[C@@H](CC1=CN=CN1)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC2=CN=CN2)C(=O)O |
| pKa | 2.76±0.10 |
What is the chemical name of Acetyl Tetrapeptide-5?
The chemical name of Acetyl Tetrapeptide-5 is N-Acetyl-beta-alanyl-L-histidyl-L-seryl-L-histidine.
What is the molecular formula of Acetyl Tetrapeptide-5?
The molecular formula of Acetyl Tetrapeptide-5 is C20H28N8O7.
What are some synonyms of Acetyl Tetrapeptide-5?
Some synonyms of Acetyl Tetrapeptide-5 are Depuffin, Acetyl tetrapeptide-5, and Acetyl Tetrapeptide.
What are the chemical properties of Acetyl Tetrapeptide-5?
Acetyl Tetrapeptide-5 is a white to cream colored powder. It is a crystalline solid with a boiling point of 1237.3±65.0 °C and a density of 1.443.
How is Acetyl Tetrapeptide-5 used in skincare?
Acetyl Tetrapeptide-5 is used to treat lachrymal sacs and dark circles under the eyes. It stimulates cell metabolism, improves skin elasticity, reduces puffiness and water retention in the eye area, and makes the skin supple.
What effects does Acetyl Tetrapeptide-5 have on the skin?
Acetyl Tetrapeptide-5 inhibits collagen glycation, prevents liquid accumulation in eyebags, shows a slight lightening effect to decrease dark circles under the eyes, and improves skin elasticity.
How is Acetyl Tetrapeptide-5 applied?
Acetyl Tetrapeptide-5 is applied as a humectant or hydroscopic moisturizer to help reduce eye puffiness, improve skin elasticity, and overall smoothness.
What are the benefits of Acetyl Tetrapeptide-5?
The benefits of Acetyl Tetrapeptide-5 include inhibiting collagen glycation, increasing vascular permeability, preventing liquid accumulation under the eyes, decreasing eye puffiness, and improving skin elasticity.
What is the maximum recommended use level of Acetyl Tetrapeptide-5?
The maximum recommended use level of Acetyl Tetrapeptide-5 is 0.1% (water soluble).
Is Acetyl Tetrapeptide-5 considered hazardous?
Acetyl Tetrapeptide-5 is generally considered non-hazardous to the body and the environment, according to the cosmetics database.
If you have any questions, please contact us. You will get a satisfactory answer.
