Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-EO-0018 |
| Product Name | Myrrh oil |
| CAS | 8016-37-3 |
| Synonyms | Hypersolublemyrrh |
| IUPAC Name | 4-[4-[4-amino-2-(hydroxymethyl)cyclopentyl]phenyl]-7-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxylic acid |
| Molecular Weight | 505.5 g/mol |
| Molecular Formula | C30H26F3NO3 |
| InChI | InChI=1S/C30H26F3NO3/c31-30(32,33)24-8-5-17(6-9-24)20-7-10-26-21(11-20)12-22(29(36)37)14-28(26)19-3-1-18(2-4-19)27-15-25(34)13-23(27)16-35/h1-12,14,23,25,27,35H,13,15-16,34H2,(H,36,37) |
| InChI Key | ZGUKBYAGUXPWLB-UHFFFAOYSA-N |
| Purity | 0.98 |
| Appearance | Liquid |
| Isomeric SMILES | C1C(CC(C1CO)C2=CC=C(C=C2)C3=C4C=CC(=CC4=CC(=C3)C(=O)O)C5=CC=C(C=C5)C(F)(F)F)N |
What are some synonyms for Myrrh oil?
Hypersolublemyrrh
Myrrh, oleo-gum-resin
Myrrh resin
Oils, myrrh
What is the boiling point of Myrrh oil?
The boiling point is 220°C (lit.)
What is the density of Myrrh oil at 25°C?
The density is 1.003 g/mL at 25°C (lit.)
What is the odor type of Myrrh oil?
The odor type is balsamic.
What is the primary chemical property of Myrrh oil?
Myrrh oil is obtained from the gum by steam distillation.
What is the typical aroma-determining compound in Myrrh oil?
Furanosesquiterpenoids like lindestrene.
How is Myrrh oil traditionally used internally?
It has been used to treat upper respiratory congestion, pharyngitis, gingivitis, mouth ulcers, and more.
How is Myrrh oil used in contemporary times?
Mostly for flavoring in foods and fragrance in cosmetic products.
In what preparations is Myrrh extract and Myrrh tincture utilized?
Oral care and corresponding preparations.
What is the preparation method for Myrrh oil?
By steam distillation of the gum.
If you have any questions, please contact us. You will get a satisfactory answer.
