Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-FC-0031 |
Product Name | Myristyl glucoside |
CAS | 54549-26-7 |
Structure | |
Synonyms | D-Glucopyranoside, tetradecyl |
IUPAC Name | (2R,3S,4S,5R)-2-(hydroxymethyl)-6-tetradecoxyoxane-3,4,5-triol |
Molecular Weight | 376.53 g/mol |
Molecular Formula | C20H40O6 |
InChI | InChI=1S/C20H40O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-25-20-19(24)18(23)17(22)16(15-21)26-20/h16-24H,2-15H2,1H3/t16-,17-,18+,19-,20?/m1/s1 |
InChI Key | ORUDEUCNYHCHPB-QUIYGKKVSA-N |
Isomeric SMILES | CCCCCCCCCCCCCCOC1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
What is the chemical formula for Myristyl glucoside?
The chemical formula for Myristyl glucoside is C20H40O6.
What is the molecular weight of Myristyl glucoside?
The molecular weight of Myristyl glucoside is 376.528.
What are some synonyms for Myristyl glucoside?
Some synonyms for Myristyl glucoside include Myristyl glucoside.
How is Myristyl glucoside different from other surfactants?
Myristyl glucoside is a mild surfactant that is derived from natural sources, making it a gentler alternative to synthetic surfactants.
What is the main function of Myristyl glucoside?
Myristyl glucoside is commonly used as a surfactant in personal care products and cosmetics.
Is Myristyl glucoside a natural or synthetic ingredient?
Myristyl glucoside is a natural ingredient derived from myristyl alcohol and glucose.
What is the role of Myristyl glucoside in skincare products?
Myristyl glucoside helps to emulsify oils and water, giving products a smooth and creamy texture.
Can Myristyl glucoside be used in hair care products?
Yes, Myristyl glucoside is often used in hair conditioners and styling products for its conditioning and emollient properties.
Are there any known side effects of using products containing Myristyl glucoside?
Myristyl glucoside is generally considered safe for use in skincare products, but individuals with sensitive skin may experience irritation.