Our customer service representatives are available 24 hours a day, from Monday to Sunday.

Myristoyl pentapeptide-4

Online Inquiry
Catalog Number CI-BP-0027
Product Name Myristoyl pentapeptide-4
IUPAC Name (2S)-2-[[(2S)-6-amino-2-[[(2S,3R)-2-[[(2S,3R)-2-[[(2S)-6-amino-2-(tetradecanoylamino)hexanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxybutanoyl]amino]hexanoyl]amino]-3-hydroxypropanoic acid
Molecular Weight 774 g/mol
Molecular Formula C37H71N7O10
InChI InChI=1S/C37H71N7O10/c1-4-5-6-7-8-9-10-11-12-13-14-21-30(48)40-27(19-15-17-22-38)34(50)43-32(26(3)47)36(52)44-31(25(2)46)35(51)41-28(20-16-18-23-39)33(49)42-29(24-45)37(53)54/h25-29,31-32,45-47H,4-24,38-39H2,1-3H3,(H,40,48)(H,41,51)(H,42,49)(H,43,50)(H,44,52)(H,53,54)/t25-,26-,27+,28+,29+,31+,32+/m1/s1
InChI Key XLELDISCQSKJES-IPPMYLEBSA-N
Isomeric SMILES CCCCCCCCCCCCCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(=O)O
Product Overview

Myristoyl Pentapeptide-4, a synthetic lipo-peptide known under the trade name Collasyn 514KS, is developed as an ester of Myristic acid and the KTTKS peptide. This compound acts as an analog to the renowned Palmitoyl Pentapeptide-4 from the Matrixyl™ line, known for its pro-collagen properties. Myristoyl Pentapeptide-4 is designed to stimulate the production of extracellular matrix (ECM) components, making it particularly beneficial in the fields of eye care and decorative cosmetics, particularly leave-on products. Typically formulated at a concentration of 0.05%, this peptide offers a lower irritation potential compared to its counterparts, allowing for use in higher concentrations while maintaining effectiveness.

Custom Q&A

What is Myristoyl Pentapeptide-4 and how does it work?

Myristoyl Pentapeptide-4 is a synthetic lipo-peptide. It is an ester composed of Myristic acid attached to the N-terminus of a KTTKS peptide. Functionally, it serves as an analog of Palmitoyl Pentapeptide-4. Myristoyl Pentapeptide-4 stimulates the production of extracellular matrix components by mimicking a pro-collagen I amino acid sequence fragment.

What are the typical applications of Myristoyl Pentapeptide-4?

Myristoyl Pentapeptide-4 is predominantly used in eye care applications and decorative cosmetics, particularly in leave-on products. Its cosmetic formulation caters to enhancing skin texture and appearance due to its ability to stimulate collagen and other extracellular matrix components.

In what concentrations is Myristoyl Pentapeptide-4 typically used?

This peptide is generally utilized in a 0.05% concentration for cosmetic formulations. This concentration enables effective stimulation of extracellular matrix components while minimizing the risk of irritation.

How does Myristoyl Pentapeptide-4 compare to Palmitoyl Pentapeptide-4?

Myristoyl Pentapeptide-4 is similar to Palmitoyl Pentapeptide-4 in function, as it also stimulates the synthesis of extracellular matrix components. However, Myristoyl Pentapeptide-4 offers a lower irritation potential compared to Palmitoyl Pentapeptide-4, allowing it to be used in higher concentrations in cosmetic products.

Are there any specific benefits of using Myristoyl Pentapeptide-4 in eye care products?

Yes, Myristoyl Pentapeptide-4 is particularly beneficial in eye care products due to its collagen-stimulating properties, which can help in reducing the appearance of fine lines and wrinkles around the delicate eye area. Its lower irritation potential makes it a suitable candidate for sensitive skin types often found in the eye region.

Online Inquiry
Verification code