Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-FC-0060 |
| Product Name | Methylglucamine |
| CAS | 6284-40-8 |
| Structure |  |
| Synonyms | 1-Deoxy-1-(methylamino)hexitol |
| IUPAC Name | (2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol |
| Molecular Weight | 195.21 g/mol |
| Molecular Formula | C7H17NO5 |
| InChI | InChI=1S/C7H17NO5/c1-8-2-4(10)6(12)7(13)5(11)3-9/h4-13H,2-3H2,1H3/t4-,5+,6+,7+/m0/s1 |
| InChI Key | MBBZMMPHUWSWHV-BDVNFPICSA-N |
| Boiling Point | 331.88 °C |
| Melting Point | 129-131.5 °C |
| Density | 1.267 g/mL |
| Isomeric SMILES | CNC[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O |
If you have any questions, please contact us. You will get a satisfactory answer.
