Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0158 |
| Product Name | 4-Methylbenzylidene Camphor |
| CAS | 36861-47-9 |
| Structure |  |
| Synonyms | Bicyclo[2.2.1]heptan-2-one, 1,7,7-trimethyl-3-((4-methylphenyl)methylene)-;Enzacamene;4-MBC |
| IUPAC Name | (3Z)-1,7,7-trimethyl-3-[(4-methylphenyl)methylidene]bicyclo[2.2.1]heptan-2-one |
| Molecular Weight | 254.37 g/mol |
| Molecular Formula | C18H22O |
| InChI | InChI=1S/C18H22O/c1-12-5-7-13(8-6-12)11-14-15-9-10-18(4,16(14)19)17(15,2)3/h5-8,11,15H,9-10H2,1-4H3/b14-11- |
| InChI Key | HEOCBCNFKCOKBX-KAMYIIQDSA-N |
| Boiling Point | 198-200 °C |
| Melting Point | 66-68 °C |
| Purity | 95% |
| Density | 1.06 g/mL |
| Appearance | Solid |
| Isomeric SMILES | CC1=CC=C(C=C1)/C=C\2/C3CCC(C2=O)(C3(C)C)C |
What is the chemical name of the compound referenced?
The chemical name of the compound is 3-(4-METHYLBENZYLIDENE)CAMPHOR.
What are some synonyms for 3-(4-METHYLBENZYLIDENE)CAMPHOR?
Some synonyms for 3-(4-METHYLBENZYLIDENE)CAMPHOR include MEXORYLSD and METHYLBENZYLIDENECAMPHOR.
What is the molecular formula of 3-(4-METHYLBENZYLIDENE)CAMPHOR?
The molecular formula is C18H22O.
What is the melting point of 3-(4-METHYLBENZYLIDENE)CAMPHOR?
The melting point is 66-68°C.
What is the hazard code for 3-(4-METHYLBENZYLIDENE)CAMPHOR?
The hazard code is Xn.
In which industry is 4-Methylbenzylidene camphor commonly used?
It is commonly used in the cosmetic industry.
What is the biological activity of 4-Methylbenzylidene camphor?
It is an ultraviolet light blocker used in cosmetics and sunscreen preparations that also has estrogenic activities.
How does 4-Methylbenzylidene camphor affect estrogen target gene expression in rats?
It alters the steady-state levels of MRNA encoding for ER, progesterone receptor, and androgen receptor in rats.
How does 4-Methylbenzylidene camphor affect cell proliferation and gene induction in mammalian and amphibian cells?
It has estrogen-like effects on cell proliferation and gene induction in mammalian and amphibian cells.
What is the solubility of 3-(4-METHYLBENZYLIDENE)CAMPHOR in different solvents?
It is insoluble in water, but soluble in DMSO and EtOH.
If you have any questions, please contact us. You will get a satisfactory answer.
