Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1227 |
| Product Name | Methylbenzyl Alcohol |
| CAS | 589-18-4 |
| Structure |  |
| Synonyms | 4-Methylbenzyl alcohol |
| IUPAC Name | (4-methylphenyl)methanol |
| Molecular Weight | 122.16 g/mol |
| Molecular Formula | C8H10O |
| InChI | InChI=1S/C8H10O/c1-7-2-4-8(6-9)5-3-7/h2-5,9H,6H2,1H3 |
| InChI Key | KMTDMTZBNYGUNX-UHFFFAOYSA-N |
| Boiling Point | 217 °C |
| Melting Point | 59-61 °C |
| Purity | 0.98 |
| Density | 0.98 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.001 |
| Isomeric SMILES | CC1=CC=C(C=C1)CO |
If you have any questions, please contact us. You will get a satisfactory answer.
