Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1170 |
| Product Name | Methyl Palmitate |
| CAS | 112-39-0 |
| Structure |  |
| Synonyms | Hexadecanoic acid, methyl ester;Palmitic acid, methyl ester |
| IUPAC Name | methyl hexadecanoate |
| Molecular Weight | 270.5 g/mol |
| Molecular Formula | C17H34O2 |
| InChI | InChI=1S/C17H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19-2/h3-16H2,1-2H3 |
| InChI Key | FLIACVVOZYBSBS-UHFFFAOYSA-N |
| Boiling Point | 185 °C / 10mmHg |
| Melting Point | 32-35 °C |
| Purity | 95% |
| Density | 0.85 g/mL |
| Appearance | Liquid or low melting solid |
| Highest Usage In Residency Products | 0.03 |
| Isomeric SMILES | CCCCCCCCCCCCCCCC(=O)OC |
What is the chemical formula for Methyl Palmitate?
The chemical formula for Methyl Palmitate is C17H34O2.
What is the molecular weight of Methyl Palmitate?
The molecular weight of Methyl Palmitate is 270.45.
What is the CAS number for Methyl Palmitate?
The CAS number for Methyl Palmitate is 112-39-0.
What is the melting point of Methyl Palmitate?
The melting point of Methyl Palmitate is 32-35 °C.
What is the boiling point of Methyl Palmitate?
The boiling point of Methyl Palmitate is 185 °C/10 mmHg.
Is Methyl Palmitate soluble in water?
Methyl Palmitate is insoluble in water.
What are some common uses of Methyl Palmitate?
Methyl Palmitate is used in the preparation of detergents, emulsifiers, lubricants, stabilizers, resins, and animal feeds. It is also used as an additive in food and cosmetic industries.
What are the safety statements associated with Methyl Palmitate?
The safety statements for Methyl Palmitate are 22-24/25.
What is the biological function of Methyl Palmitate?
Methyl Palmitate is a saturated fatty acid that is synthesized by both plants and animals for long-term energy storage. It can induce the expression of cyclooxygenase-2.
How does Methyl Palmitate affect inflammation and fibrosis?
Methyl Palmitate has anti-inflammatory and anti-fibrotic effects. It can prevent bleomycin-induced lung inflammation and fibrosis, as well as CCl4-induced liver fibrosis by inhibiting NF-κB and reducing TGF-β levels.
If you have any questions, please contact us. You will get a satisfactory answer.
