Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0104 |
| Product Name | Methyl Dihydroxybenzoate |
| CAS | 2150-46-1 |
| Structure |  |
| Synonyms | Methyl dihydroxybenzoate;Benzoic acid, 2,5-dihydroxy-, methyl ester |
| IUPAC Name | methyl 2,5-dihydroxybenzoate |
| Molecular Weight | 168.15 g/mol |
| Molecular Formula | C8H8O4 |
| InChI | InChI=1S/C8H8O4/c1-12-8(11)6-4-5(9)2-3-7(6)10/h2-4,9-10H,1H3 |
| InChI Key | XGDPKUKRQHHZTH-UHFFFAOYSA-N |
| Boiling Point | 136 °C / 1mmHg |
| Melting Point | 86-88 °C |
| Purity | 95% |
| Density | 1.354 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.03 |
| Isomeric SMILES | COC(=O)C1=C(C=CC(=C1)O)O |
| pKa | 9.87±0.18 |
What is another name for Methyl 2,5-dihydroxybenzoate?
Methyl gentisate
What is the molecular formula of Methyl 2,5-dihydroxybenzoate?
C8H8O4
What is the melting point of Methyl 2,5-dihydroxybenzoate?
86-88 °C
What is the boiling point of Methyl 2,5-dihydroxybenzoate?
136 °C / 1mmHg
What is the solubility of Methyl 2,5-dihydroxybenzoate in DMSO and methanol?
Slightly soluble in DMSO and methanol
What is the stability of Methyl 2,5-dihydroxybenzoate?
Hygroscopic
What is the hazard code for Methyl 2,5-dihydroxybenzoate?
Xi
How is Methyl 2,5-dihydroxybenzoate used in skin-lightening?
It inhibits the melanocyte's production of tyrosinase
What is the reported cytotoxic and mutagenic activity of Methyl 2,5-dihydroxybenzoate compared to hydroquinone?
Less cytotoxic and mutagenic activity
How can Methyl 2,5-dihydroxybenzoate be naturally obtained?
From gentian root
If you have any questions, please contact us. You will get a satisfactory answer.
