Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1179 |
| Product Name | Methyl Caprylate |
| CAS | 111-11-5 |
| Structure |  |
| Synonyms | Methyl octanoate;Octanoic acid, methyl ester;FEMA No. 2728 |
| IUPAC Name | methyl octanoate |
| Molecular Weight | 158.24 g/mol |
| Molecular Formula | C9H18O2 |
| InChI | InChI=1S/C9H18O2/c1-3-4-5-6-7-8-9(10)11-2/h3-8H2,1-2H3 |
| InChI Key | JGHZJRVDZXSNKQ-UHFFFAOYSA-N |
| Boiling Point | 79 °C |
| Melting Point | -40 °C |
| Purity | 95% |
| Density | 0.88 g/mL |
| Appearance | Liquid |
| Highest Usage In Residency Products | 0.01 |
| Isomeric SMILES | CCCCCCCC(=O)OC |
If you have any questions, please contact us. You will get a satisfactory answer.
