Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-FC-0012 |
| Product Name | Methoxypropylgluconamide |
| CAS | 126094-21-1 |
| Structure |  |
| Synonyms | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-N-(3-methoxypropyl)hexanamide |
| IUPAC Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-N-(3-methoxypropyl)hexanamide |
| Molecular Weight | 267.28 g/mol |
| Molecular Formula | C10H21NO7 |
| InChI | InChI=1S/C10H21NO7/c1-18-4-2-3-11-10(17)9(16)8(15)7(14)6(13)5-12/h6-9,12-16H,2-5H2,1H3,(H,11,17)/t6-,7-,8+,9-/m1/s1 |
| InChI Key | QIGYCAMGTSQFGJ-LURQLKTLSA-N |
| Isomeric SMILES | COCCCNC(=O)[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O |
What is the chemical name of METHOXYPROPYLGLUCONAMIDE?
The chemical name of METHOXYPROPYLGLUCONAMIDE is N-(3-methoxypropyl)-D-Gluconamide.
What are some synonyms for METHOXYPROPYLGLUCONAMIDE?
Some synonyms for METHOXYPROPYLGLUCONAMIDE include 3-methoxypropylgluconamide and (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-N-(3-methoxypropyl)hexanamide.
What is the CAS number for METHOXYPROPYLGLUCONAMIDE?
The CAS number for METHOXYPROPYLGLUCONAMIDE is 126094-21-1.
What is the molecular formula of METHOXYPROPYLGLUCONAMIDE?
The molecular formula of METHOXYPROPYLGLUCONAMIDE is C10H21NO7.
What is the molecular weight of METHOXYPROPYLGLUCONAMIDE?
The molecular weight of METHOXYPROPYLGLUCONAMIDE is 267.28.
Is METHOXYPROPYLGLUCONAMIDE a natural or synthetic compound?
METHOXYPROPYLGLUCONAMIDE is a synthetic compound.
What are some potential applications of METHOXYPROPYLGLUCONAMIDE?
METHOXYPROPYLGLUCONAMIDE can be used in various industries such as pharmaceuticals, cosmetics, and personal care products.
How is METHOXYPROPYLGLUCONAMIDE typically synthesized?
METHOXYPROPYLGLUCONAMIDE is typically synthesized through chemical reactions involving gluconic acid and methoxypropylamine.
Are there any known safety concerns or hazards associated with the use of METHOXYPROPYLGLUCONAMIDE?
There are no specific safety concerns or hazards associated with the use of METHOXYPROPYLGLUCONAMIDE.
If you have any questions, please contact us. You will get a satisfactory answer.
