Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0263 |
| Product Name | 6-Methoxy-2,3-Pyridinediamine HCl |
| CAS | 94166-62-8 |
| Structure |  |
| Synonyms | 2,3-Diamino-6-methoxypyridine dihydrochloride |
| IUPAC Name | 6-methoxypyridine-2,3-diamine;dihydrochloride |
| Molecular Weight | 212.08 g/mol |
| Molecular Formula | C6H11Cl2N3O |
| InChI | InChI=1S/C6H9N3O.2ClH/c1-10-5-3-2-4(7)6(8)9-5;;/h2-3H,7H2,1H3,(H2,8,9);2*1H |
| InChI Key | HFTXXPTXSCLIIP-UHFFFAOYSA-N |
| Melting Point | 167-171 °C |
| Purity | 0.98 |
| Appearance | Solid |
| Isomeric SMILES | COC1=NC(=C(C=C1)N)N.Cl.Cl |
If you have any questions, please contact us. You will get a satisfactory answer.
