Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-OT-0075 |
| Product Name | Menadione |
| CAS | 58-27-5 |
| Structure |  |
| Synonyms | Vitamin K3;1,4-Naphthalenedione, 2-methyl-;1,4-Naphthoquinone, 2-methyl- |
| IUPAC Name | 2-methylnaphthalene-1,4-dione |
| Molecular Weight | 172.18 g/mol |
| Molecular Formula | C11H8O2 |
| InChI | InChI=1S/C11H8O2/c1-7-6-10(12)8-4-2-3-5-9(8)11(7)13/h2-6H,1H3 |
| InChI Key | MJVAVZPDRWSRRC-UHFFFAOYSA-N |
| Boiling Point | 262.5 °C |
| Melting Point | 105-107 °C |
| Purity | 95% |
| Density | 1.12 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.001 |
| Isomeric SMILES | CC1=CC(=O)C2=CC=CC=C2C1=O |
If you have any questions, please contact us. You will get a satisfactory answer.
