Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0064 |
| Product Name | Melatonin |
| CAS | 73-31-4 |
| Structure |  |
| Synonyms | Acetamide, N-(2-(5-methoxyindol-3-yl)ethyl)-;5-Methoxy-N-acetyltryptamine |
| IUPAC Name | N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide |
| Molecular Weight | 232 g/mol |
| Molecular Formula | C13H16N2O2 |
| InChI | InChI=1S/C13H16N2O2/c1-9(16)14-6-5-10-8-15-13-4-3-11(17-2)7-12(10)13/h3-4,7-8,15H,5-6H2,1-2H3,(H,14,16) |
| InChI Key | DRLFMBDRBRZALE-UHFFFAOYSA-N |
| Boiling Point | 374.5 °C |
| Melting Point | 116.5-118 °C |
| Purity | 95% |
| Density | 1.11 g/mL |
| Appearance | Solid |
| Isomeric SMILES | CC(=O)NCCC1=CNC2=C1C=C(C=C2)OC |
If you have any questions, please contact us. You will get a satisfactory answer.
