Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0023 |
| Product Name | MDM Hydantoin |
| CAS | 116-25-6 |
| Structure |  |
| Synonyms | 1-Hydroxymethyl-5,5-dimethylhydantoin;MDMH |
| IUPAC Name | 1-(hydroxymethyl)-5,5-dimethylimidazolidine-2,4-dione |
| Molecular Weight | 158.16 g/mol |
| Molecular Formula | C6H10N2O3 |
| InChI | InChI=1S/C6H10N2O3/c1-6(2)4(10)7-5(11)8(6)3-9/h9H,3H2,1-2H3,(H,7,10,11) |
| InChI Key | SIQZJFKTROUNPI-UHFFFAOYSA-N |
| Melting Point | 104-106 °C |
| Purity | 95% |
| Density | 1.257 g/mL |
| Solubility | Freely soluble in water |
| Appearance | Solid |
| Isomeric SMILES | CC1(C(=O)NC(=O)N1CO)C |
| pKa | 8.28±0.10 |
If you have any questions, please contact us. You will get a satisfactory answer.
