Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-FC-0101 |
| Product Name | Mannose |
| CAS | 530-26-7 |
| Structure |  |
| Synonyms | (3S,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| IUPAC Name | (3S,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| Molecular Weight | 180.16 g/mol |
| Molecular Formula | C6H12O6 |
| InChI | InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5+,6?/m1/s1 |
| InChI Key | WQZGKKKJIJFFOK-QTVWNMPRSA-N |
| Boiling Point | 410.8±45.0 °C |
| Density | 1.732 g/mL |
| Isomeric SMILES | C([C@@H]1[C@H]([C@@H]([C@@H](C(O1)O)O)O)O)O |
Mannose, a simple monosaccharide and stereoisomer of glucose, is prevalent in both plants and the human body. While not an essential nutrient-since it can convert to and from glucose-it is vital in numerous biological processes, including protein glycosylation. This sugar demonstrates antibiotic-like properties by binding to microbial membranes, helping to inhibit the growth of certain harmful bacteria while supporting the beneficial microbiota that maintain skin health. In skincare applications, mannose boosts cellular energy by entering through glucose channels and participating in the glycolytic cycle to generate ATP, thereby enhancing cellular function. Additionally, its multiple hydroxy groups provide excellent water-binding capabilities, improving skin hydration and reducing moisture loss. This leads to a smoother, more elastic skin surface with increased volume and density. Mannose also accelerates skin regeneration and wound healing, showing potential in reducing inflammation and alleviating conditions such as atopic dermatitis.
What is Mannose, and where is it found?
Mannose is a simple monosaccharide sugar and a stereoisomer of glucose. It is found naturally in many plants and the human body. Mannose plays a critical role in various biological processes, particularly in protein glycosylation.
Is Mannose considered an essential nutrient for the human body?
No, Mannose is not considered an essential nutrient because it can be converted into glucose and vice versa. This interconversion means that the body can produce mannose from glucose if needed.
How does Mannose exhibit antibiotic-like action?
Mannose can bind to the membranes of certain harmful bacteria, preventing their growth and proliferation. This binding action is similar to how antibiotics work, and it helps to maintain the balance of the skin's microflora, supporting healthier skin.
What benefits does Mannose offer in skincare?
Mannose provides several benefits in skincare due to its ability to enhance water retention and reduce moisture loss. It smooths the skin's surface, provides volume and density, and improves elasticity. It also accelerates regenerative processes, speeds up wound healing, and can reduce inflammation, making it a potential treatment for conditions like atopic dermatitis.
Can Mannose help with inflammation in the skin?
Yes, Mannose can help reduce skin inflammation by lowering the count of neutrophils and inflammatory keratinocytes. Its anti-inflammatory properties suggest it could be beneficial for treating skin conditions such as atopic dermatitis.
Does Mannose have any impact on wound healing?
Mannose has been shown to accelerate wound healing by promoting regenerative processes in the skin. This makes it a valuable ingredient in skincare formulations aimed at repairing and rejuvenating the skin.
If you have any questions, please contact us. You will get a satisfactory answer.
