Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-FC-0026 |
| Product Name | Manganese gluconate |
| CAS | 6485-39-8 |
| Structure |  |
| Synonyms | D-Gluconic acid manganese complex |
| IUPAC Name | manganese(2+);(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| Molecular Weight | 443.22 g/mol |
| Molecular Formula | C12H20MnO14 |
| InChI | InChI=1S/2C6H12O7.Mn/c2*7-1-2(8)3(9)4(10)5(11)6(12)13;/h2*2-5,7-11H,1H2,(H,12,13);/q;;+2/p-2/t2*2-,3-,4+,5-;/m11./s1 |
| InChI Key | OXHQNTSSPHKCPB-IYEMJOQQSA-L |
| Flash Point | 100 °C |
| Purity | 0.98 |
| Solubility | Soluble in water |
| Appearance | Solid |
| Isomeric SMILES | C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O.C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O.[Mn+2] |
What is the chemical formula of Manganese gluconate?
The chemical formula of Manganese gluconate is C12H20MnO14.
What is the molecular weight of Manganese gluconate?
The molecular weight of Manganese gluconate is 443.22.
In what form is Manganese gluconate typically found?
Manganese gluconate is found in a solid form.
What is the color of Manganese gluconate?
The color of Manganese gluconate is pink.
How soluble is Manganese gluconate in water?
Manganese gluconate is soluble in hot water.
What are the main uses of Manganese gluconate?
Manganese gluconate is used as a food additive, a vitamin, and a dietary supplement.
Where can Manganese gluconate be found naturally?
Manganese gluconate can be found in green leafy vegetables, legumes, and brewer's yeast.
What is the specific chemical property of Manganese gluconate that makes it a skin conditioner?
Manganese gluconate improves or maintains the skin's texture and feel.
How is Manganese gluconate typically obtained in a manufacturing process?
Manganese gluconate can be obtained by reacting manganese carbonate with gluconic acid in an aqueous medium and then crystallizing the product.
In what kind of products can Manganese gluconate be used as an ingredient?
Manganese gluconate can be used in baked goods, non-alcoholic beverages, dairy product analogs, fish products, meat products, milk products, poultry products, and infant formulas.
If you have any questions, please contact us. You will get a satisfactory answer.
