Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-FC-0086 |
| Product Name | Maltose |
| CAS | 69-79-4 |
| Structure |  |
| Synonyms | 4-O-alpha-D-Glucopyranosyl-beta-D-glucopyranose |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol |
| Molecular Weight | 342.3 g/mol |
| Molecular Formula | C12H22O11 |
| InChI | InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5-,6+,7-,8-,9-,10-,11-,12-/m1/s1 |
| InChI Key | GUBGYTABKSRVRQ-QUYVBRFLSA-N |
| Boiling Point | 397.76 °C |
| Melting Point | 110 °C |
| Purity | 0.95 |
| Density | 1.54 g/mL |
| Solubility | Soluble in water |
| Appearance | White powder |
| Isomeric SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@@H]2[C@H](O[C@H]([C@@H]([C@H]2O)O)O)CO)O)O)O)O |
If you have any questions, please contact us. You will get a satisfactory answer.
