Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-FC-0073 |
| Product Name | Maltitol |
| CAS | 585-88-6 |
| Structure |  |
| Synonyms | 4-O-.alpha.-D-GlucopyronosylD-sorbitol |
| IUPAC Name | (2S,3R,4R,5R)-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,3,5,6-pentol |
| Molecular Weight | 344.31 g/mol |
| Molecular Formula | C12H24O11 |
| InChI | InChI=1S/C12H24O11/c13-1-4(16)7(18)11(5(17)2-14)23-12-10(21)9(20)8(19)6(3-15)22-12/h4-21H,1-3H2/t4-,5+,6+,7+,8+,9-,10+,11+,12+/m0/s1 |
| InChI Key | VQHSOMBJVWLPSR-WUJBLJFYSA-N |
| Boiling Point | 399.42 °C |
| Melting Point | 149-152 °C |
| Purity | 0.95 |
| Density | 1.39 g/mL |
| Solubility | Soluble in water |
| Appearance | White powder |
| Isomeric SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@H]([C@@H](CO)O)[C@@H]([C@H](CO)O)O)O)O)O)O |
If you have any questions, please contact us. You will get a satisfactory answer.
