Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-OT-0047 |
| Product Name | Magnesium Glycerophosphate |
| CAS | 927-20-8 |
| Structure |  |
| Synonyms | Calcium glycerophosphate |
| IUPAC Name | magnesium;2,3-dihydroxypropyl phosphate |
| Molecular Weight | 194.36 g/mol |
| Molecular Formula | C3H7MgO6P |
| InChI | InChI=1S/C3H9O6P.Mg/c4-1-3(5)2-9-10(6,7)8;/h3-5H,1-2H2,(H2,6,7,8);/q;+2/p-2 |
| InChI Key | BHJKUVVFSKEBEX-UHFFFAOYSA-L |
| Purity | 90% |
| Density | 1.86 g/mL |
| Appearance | Solid |
| Isomeric SMILES | C(C(COP(=O)([O-])[O-])O)O.[Mg+2] |
If you have any questions, please contact us. You will get a satisfactory answer.
