Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-FC-0082 |
| Product Name | Magnesium gluconate |
| CAS | 3632-91-5 |
| Structure |  |
| Synonyms | D-Gluconic acid hemimagnesium salt, D-Gluconic acid magnesium salt |
| IUPAC Name | magnesium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| Molecular Weight | 222.48 g/mol |
| Molecular Formula | C6H14MgO7 |
| InChI | InChI=1S/2C6H12O7.Mg/c2*7-1-2(8)3(9)4(10)5(11)6(12)13;/h2*2-5,7-11H,1H2,(H,12,13);/q;;+2/p-2/t2*2-,3-,4+,5-;/m11./s1 |
| InChI Key | CTUVIUYTHWPELF-IYEMJOQQSA-L |
| Flash Point | 100 °C |
| Purity | 0.98 |
| Density | 1.46 g/mL |
| Solubility | Freely soluble in water |
| Appearance | Solid |
| Isomeric SMILES | C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O.C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O.[Mg+2] |
If you have any questions, please contact us. You will get a satisfactory answer.
