Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0265 |
| Product Name | m-Aminophenol Sulfate |
| CAS | 68239-81-6 |
| Structure |  |
| Synonyms | 3-Aminophenol hemisulfate |
| IUPAC Name | 3-aminophenol;sulfuric acid |
| Molecular Weight | 316.33 g/mol |
| Molecular Formula | C12H16N2O6S |
| InChI | InChI=1S/2C6H7NO.H2O4S/c2*7-5-2-1-3-6(8)4-5;1-5(2,3)4/h2*1-4,8H,7H2;(H2,1,2,3,4) |
| InChI Key | TVBNHNUPRXSKHS-UHFFFAOYSA-N |
| Purity | 0.98 |
| Appearance | Solid |
| Isomeric SMILES | C1=CC(=CC(=C1)O)N.C1=CC(=CC(=C1)O)N.OS(=O)(=O)O |
If you have any questions, please contact us. You will get a satisfactory answer.
