Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0264 |
| Product Name | m-Aminophenol HCl |
| CAS | 51-81-0 |
| Structure |  |
| Synonyms | 3-Hydroxyaniliniumchloride |
| IUPAC Name | 3-aminophenol;hydrochloride |
| Molecular Weight | 145.59 g/mol |
| Molecular Formula | C6H8ClNO |
| InChI | InChI=1S/C6H7NO.ClH/c7-5-2-1-3-6(8)4-5;/h1-4,8H,7H2;1H |
| InChI Key | DCBCSMXGLXAXDM-UHFFFAOYSA-N |
| Melting Point | 228 °C |
| Purity | 0.98 |
| Appearance | Solid |
| Isomeric SMILES | C1=CC(=CC(=C1)O)N.Cl |
If you have any questions, please contact us. You will get a satisfactory answer.
