Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-BP-0072 |
Product Name | Lysyl-L-threonyl-L-phenylalanyl |
CAS | 887140-79-6 |
Structure | |
Synonyms | Palmitoyl tetrapeptide-10 |
IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[(2S,3R)-2-[[(2S)-6-amino-2-(hexadecanoylamino)hexanoyl]amino]-3-hydroxybutanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid |
Molecular Weight | 761.05 g/mol |
Molecular Formula | C41H72N6O7 |
InChI | InChI=1S/C41H72N6O7/c1-3-4-5-6-7-8-9-10-11-12-13-14-18-27-36(49)44-33(25-19-21-28-42)38(50)47-37(31(2)48)40(52)46-35(30-32-23-16-15-17-24-32)39(51)45-34(41(53)54)26-20-22-29-43/h15-17,23-24,31,33-35,37,48H,3-14,18-22,25-30,42-43H2,1-2H3,(H,44,49)(H,45,51)(H,46,52)(H,47,50)(H,53,54)/t31-,33+,34+,35+,37+/m1/s1 |
InChI Key | XCEMXBAGNZCOHW-JPZUFNMASA-N |
Purity | 0.95 |
Appearance | White powder |
Storage | -15~-20 °C |
Isomeric SMILES | CCCCCCCCCCCCCCCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CCCCN)C(=O)O |
Safety | No heavy metals, no skin and eye irritation |
What is the chemical name for Palmitoyl Tetrapeptide-10?
The chemical name for Palmitoyl Tetrapeptide-10 is L-Lysine, N2-(1-oxohexadecyl)-L-lysyl-L-threony
What are the synonyms for Palmitoyl Tetrapeptide-10?
The synonyms for Palmitoyl Tetrapeptide-10 are Palmitoyl Tetrapeptide-10;L-Lysine, N2-(1-oxohexadecyl)-L-lysyl-L-threonyl-L-phenylalanyl-; N2-(1-oxohexadecyl)-L;lysyl-L-threonyl-L-phenylalanyl.
What is the molecular formula for Palmitoyl Tetrapeptide-10?
The molecular formula for Palmitoyl Tetrapeptide-10 is C41H72N6O7.
What is the molecular weight of Palmitoyl Tetrapeptide-10?
The molecular weight of Palmitoyl Tetrapeptide-10 is 761.05.
How is Palmitoyl Tetrapeptide-10 beneficial for the skin?
Palmitoyl Tetrapeptide-10 keeps the skin smooth and transparent like a crystal, repairs the skin appearance, and preserves moisture.
What is the recommended dosage of Palmitoyl Tetrapeptide-10 in skin care products?
The recommended dosage of Palmitoyl Tetrapeptide-10 in skin care products is 3%.
What is the CAS number for Palmitoyl Tetrapeptide-10?
The CAS number for Palmitoyl Tetrapeptide-10 is 887140-79-6.
How does Palmitoyl Tetrapeptide-10 repair the skin appearance?
Palmitoyl Tetrapeptide-10 repairs the skin appearance by keeping it smooth and transparent.
How does Palmitoyl Tetrapeptide-10 preserve moisture in the skin?
Palmitoyl Tetrapeptide-10 preserves moisture in the skin by helping to maintain hydration levels.