Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1117 |
| Product Name | Lysine HCl |
| CAS | 657-27-2 |
| Structure |  |
| Synonyms | L-Lysine hydrochloride |
| IUPAC Name | (2S)-2,6-diaminohexanoic acid;hydrochloride |
| Molecular Weight | 182.65 g/mol |
| Molecular Formula | C6H15ClN2O2 |
| InChI | InChI=1S/C6H14N2O2.ClH/c7-4-2-1-3-5(8)6(9)10;/h5H,1-4,7-8H2,(H,9,10);1H/t5-;/m0./s1 |
| InChI Key | BVHLGVCQOALMSV-JEDNCBNOSA-N |
| Melting Point | 263 °C |
| Purity | 95% |
| Density | 1.28 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.09 |
| Isomeric SMILES | C(CCN)C[C@@H](C(=O)O)N.Cl |
If you have any questions, please contact us. You will get a satisfactory answer.
