Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0245 |
| Product Name | Lysine |
| CAS | 56-87-1 |
| Structure |  |
| Synonyms | L-Lysine, Lysin |
| IUPAC Name | (2S)-2,6-diaminohexanoic acid |
| Molecular Weight | 146.19 g/mol |
| Molecular Formula | C6H14N2O2 |
| InChI | InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10)/t5-/m0/s1 |
| InChI Key | KDXKERNSBIXSRK-YFKPBYRVSA-N |
| Boiling Point | 265.5 °C |
| Melting Point | 215 °C |
| Purity | 95% |
| Density | 1.14 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.22 |
| Isomeric SMILES | C(CCN)C[C@@H](C(=O)O)N |
| pKa | 2.16 |
If you have any questions, please contact us. You will get a satisfactory answer.
