Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1291 |
| Product Name | Leucine |
| CAS | 61-90-5 |
| Structure |  |
| Synonyms | Leucine;2-Amino-4-methylpentanoic acid, L-;FEMA No. 3297;Leu |
| IUPAC Name | (2S)-2-amino-4-methylpentanoic acid |
| Molecular Weight | 131.17 g/mol |
| Molecular Formula | C6H13NO2 |
| InChI | InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1 |
| InChI Key | ROHFNLRQFUQHCH-YFKPBYRVSA-N |
| Flash Point | 145-148°C |
| Purity | 95% |
| Density | 1.29 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.0571 |
| Isomeric SMILES | CC(C)C[C@@H](C(=O)O)N |
| pKa | 2.33 |
If you have any questions, please contact us. You will get a satisfactory answer.
