Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0036 |
| Product Name | Lauramide MIPA |
| CAS | 142-54-1 |
| Structure |  |
| Synonyms | Dodecanamide, N-(2-hydroxypropyl)- |
| Description | Lauramide MIPA is a synthetic cosmetic ingredient that is derived from lauric acid, which is a fatty acid commonly found in coconut oil. It is commonly used as a thickening agent and emulsifier in personal care and cosmetic products, such as shampoos, conditioners, and body washes. Lauramide MIPA is known for its ability to enhance the foaming properties of these products, giving them a more luxurious and creamy texture. Lauramide MIPA is also used as a skin conditioning agent, helping to improve the texture and feel of the skin. It may also have antimicrobial properties, making it useful in products designed to treat acne or other skin conditions. |
| IUPAC Name | N-(2-hydroxypropyl)dodecanamide |
| Molecular Weight | 257.41 g/mol |
| Molecular Formula | C15H31NO2 |
| Canonical SMILES | CCCCCCCCCCCC(=O)NCC(C)O |
| InChI | MMBILEWCGWTAOV-UHFFFAOYSA-N |
| InChI Key | InChI=1S/C15H31NO2/c1-3-4-5-6-7-8-9-10-11-12-15(18)16-13-14(2)17/h14,17H,3-13H2,1-2H3,(H,16,18) |
| Boiling Point | 418.5±28.0 °C |
| Melting Point | 65-66 °C |
| Density | 0.919±0.06 g/mL |
| Appearance | yellowish or amber-colored liquid |
| Application | 1. Lauramide MIPA is widely used as a surfactant and foam booster in various personal care products such as shampoos, facial cleansers, body washes, and hand soaps. 2. It provides emulsifying and thickening properties to these products, resulting in a creamy and luxurious lather. 3. Lauramide MIPA also aids in the solubilization of other ingredients in the formula, enhancing their efficacy. 4. It acts as a skin conditioning agent, imparting a silky and smooth feel to the skin. 5. In addition, Lauramide MIPA can act as a viscosity regulator, helping to control the thickness and flow of the product. |
| Features And Benefits | 1. Acts as a foaming agent 2. Provides viscosity and stability 3. Enhances cleansing properties 4. Improves texture of the product 5. Can be used in combination with other surfactants for superior performance. |
What is the chemical formula of Lauramide MIPA?
The chemical formula of Lauramide MIPA is C15H31NO2.
What is the molecular weight of Lauramide MIPA?
The molecular weight of Lauramide MIPA is 257.41 g/mol.
What is the melting point of Lauramide MIPA?
The melting point of Lauramide MIPA is 65-66 °C.
What is the boiling point of Lauramide MIPA?
The boiling point of Lauramide MIPA is 418.3±28.0 °C.
What is the color of Lauramide MIPA?
Lauramide MIPA is white to off-white in color.
What solvents is Lauramide MIPA slightly soluble in?
Lauramide MIPA is slightly soluble in chloroform, DMSO, and methanol.
What is the LogP value of Lauramide MIPA?
The estimated LogP value of Lauramide MIPA is 4.112.
What is the EPA Substance Registry System entry for Lauramide MIPA?
The EPA Substance Registry System entry for Lauramide MIPA is Dodecanamide, N-(2-hydroxypropyl)- (142-54-1).
What is the main usage of N-(2-hydroxypropyl)dodecanamide?
N-(2-hydroxypropyl)dodecanamide can be used in cosmetic cleansing compositions that are free of sodium chloride and sulfate-based surfactants.
How is N-(2-hydroxypropyl)dodecanamide defined in ChEBI?
N-(2-hydroxypropyl)dodecanamide is defined as a fatty amide in ChEBI.
If you have any questions, please contact us. You will get a satisfactory answer.
