Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0037 |
| Product Name | Lauramide MEA |
| CAS | 142-78-9 |
| Structure |  |
| Synonyms | Dodecanamide, N-(2-hydroxyethyl)-;N-(2-Hydroxyethyl)dodecanamide;Lauric acid monoethanolamide |
| Description | Lauramide MEA is a type of ingredient that is commonly used in cosmetic and personal care products such as shampoos, bath soaps, and facial cleansers. It is produced by combining lauric acid, a fatty acid derived from coconut oil, with monoethanolamine (MEA). Lauramide MEA is used as a surfactant, which means it helps to reduce the surface tension of liquids and allows them to spread more easily. In skincare products, it helps to form a rich and creamy lather, which can effectively remove dirt, oil, and other impurities from the skin. Lauramide MEA also has emulsifying properties, which allows it to help blend water and oil-based ingredients together. This makes it useful in many cosmetics, as it can help to stabilize the formulation and prevent separating. In addition to its surfactant and emulsifying properties, Lauramide MEA can also act as a conditioning agent, helping to improve the texture and softness of the skin and hair. |
| IUPAC Name | N-(2-hydroxyethyl)dodecanamide |
| Molecular Weight | 243.39 g/mol |
| Molecular Formula | C14H29NO2 |
| Canonical SMILES | CCCCCCCCCCCC(=O)NCCO |
| InChI | QZXSMBBFBXPQHI-UHFFFAOYSA-N |
| InChI Key | InChI=1S/C14H29NO2/c1-2-3-4-5-6-7-8-9-10-11-14(17)15-12-13-16/h16H,2-13H2,1H3,(H,15,17) |
| Boiling Point | 410.5±28.0 °C |
| Melting Point | 88-89 °C |
| Density | 0.925 g/mL |
| Appearance | white, waxy solid at room temperature |
| Application | 1. Lauramide MEA is a surfactant, which means it can emulsify and disperse oils and dirt, making it useful in various personal care products. 2. It is often used as a thickener or foaming agent in shampoos, body washes, and facial cleansers. 3. Lauramide MEA can also improve the texture and feel of hair and skin after use of personal care products. 4. Due to its ability to form a stable emulsion, Lauramide MEA can also be used in some food and beverage products as an emulsifying agent. 5. In addition to its use in personal care and food products, Lauramide MEA is used in various industrial applications, such as in lubricants and corrosion inhibitors. |
| Features And Benefits | 1. Acts as a foam booster 2. Increases product viscosity 3. Acts as a thickening agent 4. Enhances foam stability 5. Acts as a cleansing agent 6. Helps moisturize and condition the skin 7. Softens and smoothens the skin 8. Improves lather and foam quality in shampoos and body washes. |
If you have any questions, please contact us. You will get a satisfactory answer.
