Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-OT-0091 |
| Product Name | Lactoflavin |
| CAS | 83-88-5 |
| Structure |  |
| Synonyms | Vitamin B2;Lactoflavin |
| IUPAC Name | 7,8-dimethyl-10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridine-2,4-dione |
| Molecular Weight | 376.36 g/mol |
| Molecular Formula | C15H24N2O |
| InChI | InChI=1S/C17H20N4O6/c1-7-3-9-10(4-8(7)2)21(5-11(23)14(25)12(24)6-22)15-13(18-9)16(26)20-17(27)19-15/h3-4,11-12,14,22-25H,5-6H2,1-2H3,(H,20,26,27)/t11-,12+,14-/m0/s1 |
| InChI Key | AUNGANRZJHBGPY-SCRDCRAPSA-N |
| Boiling Point | 505 °C |
| Melting Point | 290 °C |
| Purity | 95% |
| Density | 1.21 g/mL |
| Appearance | Solid |
| Isomeric SMILES | CC1=CC2=C(C=C1C)N(C3=NC(=O)NC(=O)C3=N2)C[C@@H]([C@@H]([C@@H](CO)O)O)O |
If you have any questions, please contact us. You will get a satisfactory answer.
