Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1274 |
| Product Name | Lactamide |
| CAS | 2043-43-8 |
| Structure |  |
| Synonyms | Propanamide, 2-hydroxy- |
| IUPAC Name | 2-hydroxypropanamide |
| Molecular Weight | 89.09 g/mol |
| Molecular Formula | C3H7NO2 |
| InChI | InChI=1S/C3H7NO2/c1-2(5)3(4)6/h2,5H,1H3,(H2,4,6) |
| InChI Key | SXQFCVDSOLSHOQ-UHFFFAOYSA-N |
| Boiling Point | 165 °C |
| Melting Point | 73-76 °C |
| Purity | 95% |
| Density | 1.19 g/mL |
| Appearance | Solid |
| Isomeric SMILES | CC(C(=O)N)O |
If you have any questions, please contact us. You will get a satisfactory answer.
