Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1267 |
| Product Name | Isopropylphthalimide |
| CAS | 304-17-6 |
| Structure |  |
| Synonyms | N-Isopropylphthalimide |
| IUPAC Name | 2-propan-2-ylisoindole-1,3-dione |
| Molecular Weight | 189.21 g/mol |
| Molecular Formula | C11H11NO2 |
| InChI | InChI=1S/C11H11NO2/c1-7(2)12-10(13)8-5-3-4-6-9(8)11(12)14/h3-7H,1-2H3 |
| InChI Key | VPLDXHDOGVIETL-UHFFFAOYSA-N |
| Boiling Point | 273 °C |
| Melting Point | 82-84 °C |
| Purity | 95% |
| Density | 1.16 g/mL |
| Appearance | Solid |
| Isomeric SMILES | CC(C)N1C(=O)C2=CC=CC=C2C1=O |
If you have any questions, please contact us. You will get a satisfactory answer.
