Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0196 |
| Product Name | Isopropylparaben |
| CAS | 4191-73-5 |
| Structure |  |
| Synonyms | Benzoic acid, 4-hydroxy-, 1-methylethyl ester;Benzoic acid, p-hydroxy-, isopropyl ester;Isopropyl 4-hydroxybenzoate;Isopropyl p-hydroxybenzoate |
| IUPAC Name | propan-2-yl 4-hydroxybenzoate |
| Molecular Weight | 180.2 g/mol |
| Molecular Formula | C10H12O3 |
| InChI | InChI=1S/C10H12O3/c1-7(2)13-10(12)8-3-5-9(11)6-4-8/h3-7,11H,1-2H3 |
| InChI Key | CMHMMKSPYOOVGI-UHFFFAOYSA-N |
| Boiling Point | 160 °C / 5mmHg |
| Melting Point | 84-86 °C |
| Purity | 95% |
| Density | 1.13 g/mL |
| Appearance | Solid |
| Isomeric SMILES | CC(C)OC(=O)C1=CC=C(C=C1)O |
| pKa | 8.40±0.15 |
What is the chemical formula for Isopropylparaben?
The chemical formula for Isopropylparaben is C10H12O3.
What is the molecular weight of Isopropylparaben?
The molecular weight of Isopropylparaben is 180.2.
What is the melting point of Isopropylparaben?
The melting point of Isopropylparaben is 84-86°C.
What is the boiling point of Isopropylparaben?
The boiling point of Isopropylparaben is 160°C / 5mmHg.
In what type of solvents is Isopropylparaben soluble?
Isopropylparaben is soluble in Chloroform and Ethyl Acetate.
What is the main use of Isopropylparaben?
Isopropylparaben is used as a preservative in cosmetics.
What hazard code is associated with Isopropylparaben?
The hazard code associated with Isopropylparaben is Xi.
What safety statement is associated with Isopropylparaben?
The safety statement associated with Isopropylparaben is 26-36.
What is the HS code for Isopropylparaben?
The HS code for Isopropylparaben is 2918290090.
What family does Isopropylparaben belong to?
Isopropylparaben belongs to the parabens family.
If you have any questions, please contact us. You will get a satisfactory answer.
