Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-OT-0007 |
| Product Name | Isooctyl Thioglycolate |
| CAS | 25103-09-7 |
| Structure |  |
| Synonyms | Acetic acid, 2-mercapto-, isooctyl ester;Isooctyl mercaptoacetate |
| IUPAC Name | 6-methylheptyl 2-sulfanylacetate |
| Molecular Weight | 204.33 g/mol |
| Molecular Formula | C10H20O2S |
| InChI | InChI=1S/C10H20O2S/c1-9(2)6-4-3-5-7-12-10(11)8-13/h9,13H,3-8H2,1-2H3 |
| InChI Key | RZBBHEJLECUBJT-UHFFFAOYSA-N |
| Flash Point | 133°C |
| Purity | 95% |
| Density | 0.97 g/mL |
| Appearance | Liquid |
| Isomeric SMILES | CC(C)CCCCCOC(=O)CS |
If you have any questions, please contact us. You will get a satisfactory answer.
