Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1279 |
| Product Name | Isoniacinamide |
| CAS | 1453-82-3 |
| Structure |  |
| Synonyms | 4-Carbamoylpyridine |
| IUPAC Name | pyridine-4-carboxamide |
| Molecular Weight | 122.12 g/mol |
| Molecular Formula | C6H6N2O |
| InChI | InChI=1S/C6H6N2O/c7-6(9)5-1-3-8-4-2-5/h1-4H,(H2,7,9) |
| InChI Key | VFQXVTODMYMSMJ-UHFFFAOYSA-N |
| Boiling Point | 227.5 °C |
| Melting Point | 155-157 °C |
| Purity | 95% |
| Density | 1.22 g/mL |
| Appearance | Solid |
| Isomeric SMILES | C1=CN=CC=C1C(=O)N |
If you have any questions, please contact us. You will get a satisfactory answer.
