Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-GU-0194 |
Product Name | Isobutylparaben |
CAS | 4247-02-3 |
Structure | ![]() |
Synonyms | Benzoic acid, p-hydroxy-, isobutyl ester;Isobutyl 4-hydroxybenzoate;Isobutyl p-hydroxybenzoate;4-Hydroxybenzoic acid, 2-methylpropyl ester;Isobutyl parahydroxybenzoate;Isobutylparaben |
IUPAC Name | 2-methylpropyl 4-hydroxybenzoate |
Molecular Weight | 194.23 g/mol |
Molecular Formula | C11H14O3 |
InChI | InChI=1S/C11H14O3/c1-8(2)7-14-11(13)9-3-5-10(12)6-4-9/h3-6,8,12H,7H2,1-2H3 |
InChI Key | XPJVKCRENWUEJH-UHFFFAOYSA-N |
Boiling Point | 302.3±15.0 °C |
Melting Point | 76 °C |
Purity | 95% |
Density | 1.11 g/mL |
Solubility | Insoluble in water |
Appearance | Solid |
Isomeric SMILES | CC(C)COC(=O)C1=CC=C(C=C1)O |
pKa | 8.17±0.15 |
What is the chemical structure of Isobutylparaben?
The chemical structure of Isobutylparaben is C11H14O3.
What is the melting point of Isobutylparaben?
The melting point of Isobutylparaben is 76°C.
What is the boiling point of Isobutylparaben?
The boiling point of Isobutylparaben is 302.3±15.0 °C.
Is Isobutylparaben soluble in water?
No, Isobutylparaben is insoluble in water.
What is the primary use of Isobutylparaben?
Isobutylparaben is used as an antimicrobial agent and antiseptic in the cosmetic field.
What are the safety hazard codes associated with Isobutylparaben?
The hazard codes associated with Isobutylparaben are Xi,N.
What is the color of Isobutylparaben?
Isobutylparaben is white in color.
What are some common synonyms of Isobutylparaben?
Some common synonyms of Isobutylparaben include 4-hydroxy-benzoicaci2-methylpropylester and sobutyl 4-hydroxybenzoate.
What are the storage temperature recommendations for Isobutylparaben?
The storage temperature recommendations for Isobutylparaben are 2-8°C.
Can Isobutylparaben induce allergic contact dermatitis?
Yes, Isobutylparaben can induce allergic contact dermatitis, mainly in chronic dermatitis and wounded skin.