Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-0551 |
| Product Name | Inositol |
| CAS | 87-89-8 |
| Structure |  |
| Synonyms | Meso-inositol |
| Description | Inositol is a unique new botanical complex which is processed from the fruits of Ceratonia Siliqua (carob tree). It is a multi-action tanning compound, which activates the main melanogenesis pathway thus intensifying and maintaining a suntan longer. Since it stimulates both immediate and delayed tanning, it can be applied to 'before-tanning' formulations such as sunscreens, tan accelerators, day facial creams and 'after-tanning' formulations such as tan-prolonging products, after-sun creams and lotions. |
| IUPAC Name | Cyclohexane-1,2,3,4,5,6-hexol |
| Molecular Weight | 180.16 g/mol |
| Molecular Formula | C6H12O6 |
| Canonical SMILES | C1(C(C(C(C(C1O)O)O)O)O)O |
| InChI | InChI=1S/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H |
| InChI Key | CDAISMWEOUEBRE-UHFFFAOYSA-N |
| Boiling Point | 232.96 °C |
| Melting Point | 222-227 °C(lit.) |
| Flash Point | 143.39 °C |
| Purity | 98% |
| Density | 1.75 g/mL |
| Solubility | Partly soluble in water or alcohol |
| Appearance | Solid |
| Application | Tan-prolonging products, after-sun creams and lotions |
| Storage | 2-8 °C |
| HS Code | 2936210000 |
| INCI | Inositol |
| pH | 5-7 (100g/l, H₂O, 20°C) |
| Refractive Index | 1.6170 |
| Topological Polar Surface Area | 121 Ų |
| Uses | Add to water phase of emulsions. Typical use level Use level: 0.05 - 0.10%. For external use only. |
Inositol serves as an effective skin moisturizer, playing a critical role in optimizing the skin's water-lipid barrier by integrating into membrane lipids to enhance the skin's natural defenses. Studies indicate its beneficial application for conditions such as rosacea and eczema, leading dermatologists to recommend inositol-containing emulsions for these manifestations. Notably, inositol remains stable in both open air and sunlight, delivering a gentle moisturizing effect while resisting oxidation. Additionally, it aids in normalizing the skin's salt composition, particularly calcium salts, which is a highly sought-after trait in the field of cosmetology, given that calcium salt imbalances can accelerate skin aging and the development of premature wrinkles. Consequently, many cosmetic formulations targeting age-related concerns include inositol for its multifaceted benefits.
What is the major component of fatty acid lecithin?
The major component of fatty acid lecithin is inositol.
What are some other names for inositol?
Some other names for inositol are myo-inositol and d-chiro inositol.
Is inositol a vitamin?
No, inositol is not a vitamin, but it is sometimes grouped with the B vitamins.
Where is inositol typically sourced from?
Inositol is typically sourced from plants such as corn and beets, but it can also be lab-made.
What biological processes does inositol assist in?
Inositol assists in several biological processes, including the formation of living skin cells and balancing water and salt concentrations.
How does inositol help maintain skin firmness?
Inositol, being in the same category as glycerin, has hydrating properties that can help maintain skin firmness.
What are the benefits of using inositol in skincare products?
Using inositol in skincare products can help draw and retain moisture, refresh tired skin, and stabilize product formulations.
How does inositol assist in tanning products?
Inositol can intensify and maintain the tanning effect longer by activating the main pathway of melanocyte formation.
What are some examples of skincare products that may contain inositol?
Some examples of skincare products that may contain inositol are creams, lotions, anti-aging skincare products, and facial moisturizers.
If you have any questions, please contact us. You will get a satisfactory answer.
