Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0100 |
| Product Name | Ilomastat |
| CAS | 142880-36-2 |
| Structure |  |
| Synonyms | (R)-n4-hydroxy-n1-[(s)-2-(1h-indol-3-yl)-1-methylcarbamoly-ethyl]-2-isobutyl-succinamide |
| IUPAC Name | (2R)-N'-hydroxy-N-[(2S)-3-(1H-indol-3-yl)-1-(methylamino)-1-oxopropan-2-yl]-2-(2-methylpropyl)butanediamide |
| Molecular Weight | 388.5 g/mol |
| Molecular Formula | C20H28N4O4 |
| InChI | InChI=1S/C20H28N4O4/c1-12(2)8-13(10-18(25)24-28)19(26)23-17(20(27)21-3)9-14-11-22-16-7-5-4-6-15(14)16/h4-7,11-13,17,22,28H,8-10H2,1-3H3,(H,21,27)(H,23,26)(H,24,25)/t13-,17+/m1/s1 |
| InChI Key | NITYDPDXAAFEIT-DYVFJYSZSA-N |
| Purity | 95% |
| Density | 1.228 g/mL |
| Appearance | Solid |
| Isomeric SMILES | CC(C)C[C@H](CC(=O)NO)C(=O)N[C@@H](CC1=CNC2=CC=CC=C21)C(=O)NC |
| pKa | 9.16±0.20 |
If you have any questions, please contact us. You will get a satisfactory answer.
