Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1295 |
| Product Name | Hydroxyproline |
| CAS | 51-35-4 |
| Structure |  |
| Synonyms | L-HydroxyProline |
| IUPAC Name | (2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid |
| Molecular Weight | 131.13 g/mol |
| Molecular Formula | C5H9NO3 |
| InChI | InChI=1S/C5H9NO3/c7-3-1-4(5(8)9)6-2-3/h3-4,6-7H,1-2H2,(H,8,9)/t3-,4+/m1/s1 |
| InChI Key | PMMYEEVYMWASQN-DMTCNVIQSA-N |
| Melting Point | 273 °C |
| Purity | 95% |
| Density | 1.31 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.02 |
| Isomeric SMILES | C1[C@H](CN[C@@H]1C(=O)O)O |
If you have any questions, please contact us. You will get a satisfactory answer.
