Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0018 |
| Product Name | Hydroxymethyl Dioxoazabicyclooctane |
| CAS | 6542-37-6 |
| Structure |  |
| Synonyms | 1H,3H,5H-Oxazolo[3,4-c]oxazole-7a(7H)-methanol;5-Hydroxymethyl-1-aza-3,7-dioxabicyclo[3.3.0]octane |
| IUPAC Name | 1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-ylmethanol |
| Molecular Weight | 145.16 g/mol |
| Molecular Formula | C6H11NO3 |
| InChI | InChI=1S/C6H11NO3/c8-1-6-2-9-4-7(6)5-10-3-6/h8H,1-5H2 |
| InChI Key | BFHKYHMIVDBCPC-UHFFFAOYSA-N |
| Boiling Point | 258.0±30.0 °C |
| Melting Point | 58 °C |
| Purity | 50% |
| Density | 1.125 g/mL |
| Appearance | Liquid |
| Isomeric SMILES | C1C2(COCN2CO1)CO |
If you have any questions, please contact us. You will get a satisfactory answer.
