Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0273 |
| Product Name | Hydroxyethyl-p-Phenylenediamine Sulfate |
| CAS | 93841-25-9 |
| Structure |  |
| Synonyms | 2-(2-Hydroxy)ethyl-p-phenylene diamino sulfate |
| IUPAC Name | 2-(2,5-diaminophenyl)ethanol;sulfuric acid |
| Molecular Weight | 250.27 g/mol |
| Molecular Formula | C8H14N2O5S |
| InChI | InChI=1S/C8H12N2O.H2O4S/c9-7-1-2-8(10)6(5-7)3-4-11;1-5(2,3)4/h1-2,5,11H,3-4,9-10H2;(H2,1,2,3,4) |
| InChI Key | VBSLNFWECRRALP-UHFFFAOYSA-N |
| Melting Point | >240 °C |
| Purity | 95% |
| Appearance | Solid |
| Isomeric SMILES | C1=CC(=C(C=C1N)CCO)N.OS(=O)(=O)O |
If you have any questions, please contact us. You will get a satisfactory answer.
