Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0293 |
| Product Name | Hydroxyethyl-2-Nitro-p-Toluidine |
| CAS | 100418-33-5 |
| Structure |  |
| Synonyms | 2-(4-Methyl-2-nitrophenylamino)ethanol |
| IUPAC Name | 2-(4-methyl-2-nitroanilino)ethanol |
| Molecular Weight | 196.2 g/mol |
| Molecular Formula | C9H12N2O3 |
| InChI | InChI=1S/C9H12N2O3/c1-7-2-3-8(10-4-5-12)9(6-7)11(13)14/h2-3,6,10,12H,4-5H2,1H3 |
| InChI Key | SCZQUWZLEIYDBD-UHFFFAOYSA-N |
| Boiling Point | 385.5±32.0 °C |
| Melting Point | 60-61 °C |
| Purity | 95% |
| Density | 1.3 g/mL |
| Appearance | Solid |
| Isomeric SMILES | CC1=CC(=C(C=C1)NCCO)[N+](=O)[O-] |
If you have any questions, please contact us. You will get a satisfactory answer.
