Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0304 |
| Product Name | Hydroxyethyl-3,4-Methylenedioxyaniline HCl |
| CAS | 94158-14-2 |
| Structure |  |
| Synonyms | N-(2-Hydroxyethyl)-3,4-methylenedioxyaniline hydrochloride |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylamino)ethanol;hydrochloride |
| Molecular Weight | 217.65 g/mol |
| Molecular Formula | C9H12ClNO3 |
| InChI | InChI=1S/C9H11NO3.ClH/c11-4-3-10-7-1-2-8-9(5-7)13-6-12-8;/h1-2,5,10-11H,3-4,6H2;1H |
| InChI Key | LMONVTDNVNEAQG-UHFFFAOYSA-N |
| Purity | 95% |
| Density | 1.43 g/mL |
| Appearance | Solid |
| Isomeric SMILES | C1OC2=C(O1)C=C(C=C2)NCCO.Cl |
If you have any questions, please contact us. You will get a satisfactory answer.
