Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0312 |
| Product Name | 1-Hydroxyethyl 4,5-Diamino Pyrazole Sulfate |
| CAS | 155601-30-2 |
| Structure |  |
| Synonyms | 4,5-Diamino-1-(2-hydroxyethyl)pyrazole sulfate |
| IUPAC Name | 2-(4,5-diaminopyrazol-1-yl)ethanol;sulfuric acid |
| Molecular Weight | 240.24 g/mol |
| Molecular Formula | C5H10N4O.H2O4S |
| InChI | InChI=1S/C5H10N4O.H2O4S/c6-4-3-8-9(1-2-10)5(4)7;1-5(2,3)4/h3,10H,1-2,6-7H2;(H2,1,2,3,4) |
| InChI Key | IBCDZZHMNXXYAP-UHFFFAOYSA-N |
| Melting Point | >183 °C |
| Purity | 0.98 |
| Density | 1.69-1.87 g/mL |
| Appearance | Pale orange solid |
| Isomeric SMILES | C1=NN(C(=C1N)N)CCO.OS(=O)(=O)O |
If you have any questions, please contact us. You will get a satisfactory answer.
