Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-SC-1278 |
Product Name | Hydroxycinnamic Acid |
CAS | 7400-08-0 |
Structure | |
Synonyms | 4-Hydroxycinnamic acid |
IUPAC Name | (E)-3-(4-hydroxyphenyl)prop-2-enoic acid |
Molecular Weight | 164.16 g/mol |
Molecular Formula | C9H8O3 |
InChI | InChI=1S/C9H8O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,10H,(H,11,12)/b6-3+ |
InChI Key | NGSWKAQJJWESNS-ZZXKWVIFSA-N |
Boiling Point | 251.5 °C |
Melting Point | 214 °C |
Purity | 95% |
Density | 1.21 g/mL |
Appearance | Solid |
Highest Usage In Residency Products | 0.009 |
Isomeric SMILES | C1=CC(=CC=C1/C=C/C(=O)O)O |
pKa | 4.65±0.10 |
What are some synonyms for 3-Phenylpropionic acid?
Benzenepropionic acid, hydrocinnamic, Phenylpropanoic acid, propanoicacid, Benyl propionic acid.
What is the molecular formula of 3-Phenylpropionic acid?
The molecular formula is C9H10O2.
What is the boiling point of 3-Phenylpropionic acid?
The boiling point is 280°C.
In which industries is 3-Phenylpropionic acid widely used?
It is used in food additives, cosmetics, and pharmaceuticals.
How is 3-Phenylpropionic acid prepared?
It is prepared by the hydrogenation of cinnamic acid.
What are the uses of 3-Phenylpropionic acid in the food industry?
It is used as a preservative, flavoring agent, antioxidant, and emulsifier in food.
In which cosmetic products is 3-Phenylpropionic acid commonly found?
It is used in bath gels, detergent powders, fabric softeners, mouthwashes, and toothpastes.
What kind of odor does 3-Phenylpropionic acid have?
It has a faint, sweet odor with a mildly sweet-sour, vanilla-like taste.
In what natural products is 3-Phenylpropionic acid naturally occurring?
It is found in various fruits, wines, beers, cheeses, cocoa, and mushrooms.
How is 3-Phenylpropionic acid purified?
It can be purified by crystallization from benzene, CHCl3, or pet ether.