Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-FC-0087 |
| Product Name | Hydroquinone O-α-D-Glucopyranoside |
| CAS | 84380-01-8 |
| Structure |  |
| Synonyms | Alpha-arbutin |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(4-hydroxyphenoxy)oxane-3,4,5-triol |
| Molecular Weight | 272.25 g/mol |
| Molecular Formula | C12H16O7 |
| InChI | InChI=1S/C12H16O7/c13-5-8-9(15)10(16)11(17)12(19-8)18-7-3-1-6(14)2-4-7/h1-4,8-17H,5H2/t8-,9-,10+,11-,12+/m1/s1 |
| InChI Key | BJRNKVDFDLYUGJ-ZIQFBCGOSA-N |
| Boiling Point | 561.6±50.0 °C |
| Melting Point | 195-196 °C |
| Density | 1.556 g/mL |
| Appearance | White to off-white solid |
| Isomeric SMILES | C1=CC(=CC=C1O)O[C@@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
| pKa | 10.10±0.15 |
What is the chemical name for alpha-Arbutin?
Hydroquinone O-α-D-Glucopyranoside
What is the molecular formula of alpha-Arbutin?
C12H16O7
What is the melting point of alpha-Arbutin?
195-196°C
What are the synonyms for alpha-Arbutin?
Alpha Arbutin Powder, 4-hydroquinone-alpha-d-glucopyranoside, a-Arbutin, etc.
What are the potential side effects of using alpha-Arbutin?
Burning sensation, harshness to the skin, irritations when applied on cracked skin, etc.
What is the function of alpha-Arbutin in skincare products?
Alpha-Arbutin is used as a skin brightening agent to treat sun spots, pigmentation, scars, and aging signs.
What makes alpha-Arbutin a more tolerable alternative to hydroquinone?
Alpha-Arbutin has a glycosylated hydroquinone molecule structure but with reduced irritation and melanocytotoxicity.
How does alpha-Arbutin work on the skin to lighten pigmentation?
Alpha-Arbutin acts as a tyrosinase competitive inhibitor and slows melanosome maturation, thus inhibiting melanin formation.
What are some benefits of using alpha-Arbutin in skincare products?
It ensures an even skin tone, reduces skin tanning after UV exposure, and minimizes the appearance of age spots.
How is alpha-Arbutin synthesized?
Alpha-Arbutin can be synthesized by reacting P-acetoxyphenyl-2,3,4,6-tetra-O-acetyl-α-D-glucopyranoside with anhydrous methanol and sodium methoxide as a catalyst.
If you have any questions, please contact us. You will get a satisfactory answer.
