Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0138 |
| Product Name | Hydrogen Dimethicone |
| CAS | 68037-59-2 |
| Synonyms | Siloxanes and Silicones, hydrogen methyl, dimethyl |
| IUPAC Name | dimethyl-[methyl(trimethylsilyloxy)silyl]oxy-trimethylsilyloxysilane |
| Molecular Weight | 208.48 g/mol |
| Molecular Formula | C6H20O2Si3 |
| InChI | InChI=1S/C9H28O3Si4/c1-13(10-14(2,3)4)11-16(8,9)12-15(5,6)7/h13H,1-9H3 |
| InChI Key | JFYVSVZSPWHVHN-UHFFFAOYSA-N |
| Boiling Point | >93 °C |
| Melting Point | <-60 °C |
| Purity | 30-100% |
| Density | 0.99 g/mL |
| Appearance | Liquid |
| Highest Usage In Residency Products | 0.0558 |
| Isomeric SMILES | C[SiH](O[Si](C)(C)C)O[Si](C)(C)O[Si](C)(C)C |
If you have any questions, please contact us. You will get a satisfactory answer.
