Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0210 |
| Product Name | 2,4-Hexadienoic acid, potassium salt |
| CAS | 590-00-1 |
| Structure |  |
| Synonyms | Potassium Sorbate |
| IUPAC Name | potassium;(2E,4E)-hexa-2,4-dienoate |
| Molecular Weight | 150.22 g/mol |
| Molecular Formula | C6H7KO2 |
| InChI | InChI=1S/C6H8O2.K/c1-2-3-4-5-6(7)8;/h2-5H,1H3,(H,7,8);/q;+1/p-1/b3-2+,5-4+ |
| InChI Key | CHHHXKFHOYLYRE-STWYSWDKSA-M |
| Melting Point | 270 °C |
| Purity | 95% |
| Density | 1.36 g/mL |
| Appearance | Solid |
| Isomeric SMILES | C/C=C/C=C/C(=O)[O-].[K+] |
If you have any questions, please contact us. You will get a satisfactory answer.
