Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0072 |
| Product Name | Hesperidin Methyl Chalcone |
| CAS | 24292-52-2 |
| Structure |  |
| Synonyms | 2-Propen-1-one, 1-(4-((6-O-(6-deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranosyl)oxy)-2-hydroxy-6-methoxyphenyl)-3-(3-hydroxy-4-methoxyphenyl)-, (2E)- |
| IUPAC Name | (E)-3-(3-hydroxy-4-methoxyphenyl)-1-[2-hydroxy-6-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxyphenyl]prop-2-en-1-one |
| Molecular Weight | 624.6 g/mol |
| Molecular Formula | C29H36O15 |
| InChI | InChI=1S/C29H36O15/c1-12-22(33)24(35)26(37)28(42-12)41-11-20-23(34)25(36)27(38)29(44-20)43-14-9-17(32)21(19(10-14)40-3)15(30)6-4-13-5-7-18(39-2)16(31)8-13/h4-10,12,20,22-29,31-38H,11H2,1-3H3/b6-4+/t12-,20+,22-,23+,24+,25-,26+,27+,28+,29+/m0/s1 |
| InChI Key | FDHNLHLOJLLXDH-JIYHLSBYSA-N |
| Boiling Point | 584 °C |
| Melting Point | 120 °C |
| Purity | 95% |
| Density | 1.31 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.03 |
| Isomeric SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=CC(=C(C(=C3)OC)C(=O)/C=C/C4=CC(=C(C=C4)OC)O)O)O)O)O)O)O)O |
| pKa | 6.71±0.40 |
What is the chemical formula for Hesperidin methylchalcone?
The chemical formula for Hesperidin methylchalcone is C29H36O15.
What is the melting point of Hesperidin methylchalcone?
The melting point of Hesperidin methylchalcone is 120 °C (dec.).
What is the primary use of Hesperidin methylchalcone in skincare?
Hesperidin methylchalcone is primarily used as an antioxidant in skincare, with effects on circulation for reducing dark circles and melanin synthesis.
How is Hesperidin methylchalcone extracted?
Hesperidin methylchalcone is extracted from the peel of sweet oranges.
What are the benefits of Hesperidin methylchalcone?
The benefits of Hesperidin methylchalcone include being an Anti-dark Circles, Antioxidant, Barrier Repair, and Anti-aging agent.
What is the solubility of Hesperidin methylchalcone in DMSO and Methanol?
Hesperidin methylchalcone is slightly soluble in both DMSO and Methanol.
How does Hesperidin methylchalcone affect capillary permeability around the eyes?
Hesperidin methylchalcone can reduce capillary permeability, particularly for dark circles around the eyes.
What is the optical activity of Hesperidin methylchalcone in ethanol?
The optical activity of Hesperidin methylchalcone in ethanol is [α]20/D 71°, c = 1.
What is the storage temperature recommended for Hesperidin methylchalcone?
The recommended storage temperature for Hesperidin methylchalcone is 2-8°C.
What is the CAS number for Hesperidin methylchalcone?
The CAS number for Hesperidin methylchalcone is 24292-52-2.
If you have any questions, please contact us. You will get a satisfactory answer.
