Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0244 |
| Product Name | Hematin |
| CAS | 15489-90-4 |
| Structure |  |
| Synonyms | [Dihydrogen 3,7,12,17-tetramethyl-8,13-divinyl-2,18-porphinedipropionato(2-)]hydroxyiron |
| IUPAC Name | 3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethylporphyrin-21,23-diid-2-yl]propanoic acid;iron(2+);hydrate |
| Molecular Weight | 634.5 g/mol |
| Molecular Formula | C34H34FeN4O5 |
| InChI | InChI=1S/C34H34N4O4.Fe.H2O/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25;;/h7-8,13-16H,1-2,9-12H2,3-6H3,(H4,35,36,37,38,39,40,41,42);;1H2/q;+2;/p-2 |
| InChI Key | CODDGSIFXYHHJO-UHFFFAOYSA-L |
| Melting Point | 180 °C |
| Purity | 95% |
| Appearance | Solid |
| Highest Usage In Rinsing Products | 0.005 |
| Isomeric SMILES | CC1=C(C2=CC3=NC(=CC4=C(C(=C([N-]4)C=C5C(=C(C(=N5)C=C1[N-]2)C)C=C)C)C=C)C(=C3CCC(=O)O)C)CCC(=O)O.O.[Fe+2] |
If you have any questions, please contact us. You will get a satisfactory answer.
